C12H13ClFNO3S — CID 63845886
1-(4-chloro-2-fluorophenyl)sulfonylpiperidine-3-carbaldehyde (PubChem CID 63845886) has the molecular formula C12H13ClFNO3S and a molecular weight of 305.76 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)sulfonylpiperidine-3-carbaldehyde.
| Compound Name | 1-(4-chloro-2-fluorophenyl)sulfonylpiperidine-3-carbaldehyde |
|---|---|
| PubChem CID | 63845886 |
| Molecular Formula | C12H13ClFNO3S |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)sulfonylpiperidine-3-carbaldehyde |
| SMILES | O=CC1CCCN(S(=O)(=O)c2ccc(Cl)cc2F)C1 |
| InChI | InChI=1S/C12H13ClFNO3S/c13-10-3-4-12(11(14)6-10)19(17,18)15-5-1-2-9(7-15)8-16/h3-4,6,8-9H,1-2,5,7H2 |
| InChIKey | SXIJBFDSBSVJSG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|