C10H11ClFNO4S — CID 79410117
(3S,4R)-1-(4-chloro-2-fluorophenyl)sulfonylpyrrolidine-3,4-diol (PubChem CID 79410117) has the molecular formula C10H11ClFNO4S and a molecular weight of 295.72 g/mol. Its IUPAC name is (3S,4R)-1-(4-chloro-2-fluorophenyl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-(4-chloro-2-fluorophenyl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79410117 |
| Molecular Formula | C10H11ClFNO4S |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | (3S,4R)-1-(4-chloro-2-fluorophenyl)sulfonylpyrrolidine-3,4-diol |
| SMILES | O=S(=O)(c1ccc(Cl)cc1F)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H11ClFNO4S/c11-6-1-2-10(7(12)3-6)18(16,17)13-4-8(14)9(15)5-13/h1-3,8-9,14-15H,4-5H2/t8-,9+ |
| InChIKey | IGSYZKILTLHVLH-DTORHVGOSA-N |
| XLogP | 0.21 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |