C14H18ClFN2O2S — CID 43598576
(3aR,7aS)-2-(4-chloro-2-fluorophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 43598576) has the molecular formula C14H18ClFN2O2S and a molecular weight of 332.83 g/mol. Its IUPAC name is (3aR,7aS)-2-(4-chloro-2-fluorophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aR,7aS)-2-(4-chloro-2-fluorophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 43598576 |
| Molecular Formula | C14H18ClFN2O2S |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (3aR,7aS)-2-(4-chloro-2-fluorophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | NC1CC[C@@H]2CN(S(=O)(=O)c3ccc(Cl)cc3F)C[C@@H]2C1 |
| InChI | InChI=1S/C14H18ClFN2O2S/c15-11-2-4-14(13(16)6-11)21(19,20)18-7-9-1-3-12(17)5-10(9)8-18/h2,4,6,9-10,12H,1,3,5,7-8,17H2/t9-,10+,12?/m1/s1 |
| InChIKey | ZHVRDQQGFVLROV-WFCWDVHWSA-N |
| XLogP | 2.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |