C14H17ClFNO2S — CID 115562788
2-[4-(chloromethyl)-2-fluorophenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 115562788) has the molecular formula C14H17ClFNO2S and a molecular weight of 317.81 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-2-fluorophenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 2-[4-(chloromethyl)-2-fluorophenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 115562788 |
| Molecular Formula | C14H17ClFNO2S |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[4-(chloromethyl)-2-fluorophenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | O=S(=O)(c1ccc(CCl)cc1F)N1CC2CCCC2C1 |
| InChI | InChI=1S/C14H17ClFNO2S/c15-7-10-4-5-14(13(16)6-10)20(18,19)17-8-11-2-1-3-12(11)9-17/h4-6,11-12H,1-3,7-9H2 |
| InChIKey | HWWAHWQUYGSBKL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|