C13H15F2NO2S — CID 173069403
(3aS,6aR)-2-(3,4-difluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 173069403) has the molecular formula C13H15F2NO2S and a molecular weight of 287.33 g/mol. Its IUPAC name is (3aS,6aR)-2-(3,4-difluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aS,6aR)-2-(3,4-difluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 173069403 |
| Molecular Formula | C13H15F2NO2S |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (3aS,6aR)-2-(3,4-difluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C13H15F2NO2S/c14-12-5-4-11(6-13(12)15)19(17,18)16-7-9-2-1-3-10(9)8-16/h4-6,9-10H,1-3,7-8H2/t9-,10+ |
| InChIKey | AHTPRYYRZTVNIA-AOOOYVTPSA-N |
| XLogP | 2.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |