C11H13F2NO4S2 — CID 97354830
(3S)-1-(3,4-difluorophenyl)sulfonyl-3-methylsulfonylpyrrolidine (PubChem CID 97354830) has the molecular formula C11H13F2NO4S2 and a molecular weight of 325.36 g/mol. Its IUPAC name is (3S)-1-(3,4-difluorophenyl)sulfonyl-3-methylsulfonylpyrrolidine.
| Compound Name | (3S)-1-(3,4-difluorophenyl)sulfonyl-3-methylsulfonylpyrrolidine |
|---|---|
| PubChem CID | 97354830 |
| Molecular Formula | C11H13F2NO4S2 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | (3S)-1-(3,4-difluorophenyl)sulfonyl-3-methylsulfonylpyrrolidine |
| SMILES | CS(=O)(=O)[C@H]1CCN(S(=O)(=O)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C11H13F2NO4S2/c1-19(15,16)9-4-5-14(7-9)20(17,18)8-2-3-10(12)11(13)6-8/h2-3,6,9H,4-5,7H2,1H3/t9-/m0/s1 |
| InChIKey | YGWYBRWQODTSCB-VIFPVBQESA-N |
| XLogP | 0.77 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |