C13H19NO6S2 — CID 90584724
1-(3,4-dimethoxyphenyl)sulfonyl-3-methylsulfonylpyrrolidine (PubChem CID 90584724) has the molecular formula C13H19NO6S2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-3-methylsulfonylpyrrolidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-3-methylsulfonylpyrrolidine |
|---|---|
| PubChem CID | 90584724 |
| Molecular Formula | C13H19NO6S2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-3-methylsulfonylpyrrolidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(S(C)(=O)=O)C2)cc1OC |
| InChI | InChI=1S/C13H19NO6S2/c1-19-12-5-4-10(8-13(12)20-2)22(17,18)14-7-6-11(9-14)21(3,15)16/h4-5,8,11H,6-7,9H2,1-3H3 |
| InChIKey | VVEAOMOQVXJPHT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |