C14H22N2O4S — CID 119979838
1-(3,4-dimethoxyphenyl)sulfonyl-N-methylpiperidin-4-amine (PubChem CID 119979838) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-N-methylpiperidin-4-amine.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 119979838 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-N-methylpiperidin-4-amine |
| SMILES | CNC1CCN(S(=O)(=O)c2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C14H22N2O4S/c1-15-11-6-8-16(9-7-11)21(17,18)12-4-5-13(19-2)14(10-12)20-3/h4-5,10-11,15H,6-9H2,1-3H3 |
| InChIKey | BIUBGCSHVQBTTB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |