C15H20N4O4S — CID 121165181
1-(3,4-dimethoxyphenyl)sulfonyl-4-(triazol-2-yl)piperidine (PubChem CID 121165181) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-4-(triazol-2-yl)piperidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-4-(triazol-2-yl)piperidine |
|---|---|
| PubChem CID | 121165181 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-4-(triazol-2-yl)piperidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(n3nccn3)CC2)cc1OC |
| InChI | InChI=1S/C15H20N4O4S/c1-22-14-4-3-13(11-15(14)23-2)24(20,21)18-9-5-12(6-10-18)19-16-7-8-17-19/h3-4,7-8,11-12H,5-6,9-10H2,1-2H3 |
| InChIKey | CBOUMSFZFPZOQD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |