C16H20N2O4S2 — CID 110289836
2-[1-(3,4-dimethoxyphenyl)sulfonylpiperidin-4-yl]-1,3-thiazole (PubChem CID 110289836) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-[1-(3,4-dimethoxyphenyl)sulfonylpiperidin-4-yl]-1,3-thiazole.
| Compound Name | 2-[1-(3,4-dimethoxyphenyl)sulfonylpiperidin-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 110289836 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-[1-(3,4-dimethoxyphenyl)sulfonylpiperidin-4-yl]-1,3-thiazole |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(c3nccs3)CC2)cc1OC |
| InChI | InChI=1S/C16H20N2O4S2/c1-21-14-4-3-13(11-15(14)22-2)24(19,20)18-8-5-12(6-9-18)16-17-7-10-23-16/h3-4,7,10-12H,5-6,8-9H2,1-2H3 |
| InChIKey | XSIAVCDXVIJIJV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |