C15H16N2O4S2 — CID 110628834
3-[4-(1,3-thiazol-2-yl)piperidin-1-yl]sulfonylbenzoic acid (PubChem CID 110628834) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 3-[4-(1,3-thiazol-2-yl)piperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 3-[4-(1,3-thiazol-2-yl)piperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 110628834 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 3-[4-(1,3-thiazol-2-yl)piperidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)N2CCC(c3nccs3)CC2)c1 |
| InChI | InChI=1S/C15H16N2O4S2/c18-15(19)12-2-1-3-13(10-12)23(20,21)17-7-4-11(5-8-17)14-16-6-9-22-14/h1-3,6,9-11H,4-5,7-8H2,(H,18,19) |
| InChIKey | CALUCOQVYGISIY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |