C19H21NO5S2 — CID 90589462
1-[3-[4-(benzenesulfonyl)piperidin-1-yl]sulfonylphenyl]ethanone (PubChem CID 90589462) has the molecular formula C19H21NO5S2 and a molecular weight of 407.51 g/mol. Its IUPAC name is 1-[3-[4-(benzenesulfonyl)piperidin-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[3-[4-(benzenesulfonyl)piperidin-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 90589462 |
| Molecular Formula | C19H21NO5S2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-[3-[4-(benzenesulfonyl)piperidin-1-yl]sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCC(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C19H21NO5S2/c1-15(21)16-6-5-9-19(14-16)27(24,25)20-12-10-18(11-13-20)26(22,23)17-7-3-2-4-8-17/h2-9,14,18H,10-13H2,1H3 |
| InChIKey | SXFGTFWALSSJTK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |