C19H20ClNO3S2 — CID 90629946
1-[3-[[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]sulfonyl]phenyl]ethanone (PubChem CID 90629946) has the molecular formula C19H20ClNO3S2 and a molecular weight of 409.96 g/mol. Its IUPAC name is 1-[3-[[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]sulfonyl]phenyl]ethanone.
| Compound Name | 1-[3-[[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]sulfonyl]phenyl]ethanone |
|---|---|
| PubChem CID | 90629946 |
| Molecular Formula | C19H20ClNO3S2 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 1-[3-[[7-(2-chlorophenyl)-1,4-thiazepan-4-yl]sulfonyl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCSC(c3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C19H20ClNO3S2/c1-14(22)15-5-4-6-16(13-15)26(23,24)21-10-9-19(25-12-11-21)17-7-2-3-8-18(17)20/h2-8,13,19H,9-12H2,1H3 |
| InChIKey | GGGFSSDINMNJCL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |