C17H18ClNO2S2 — CID 90629912
4-(benzenesulfonyl)-7-(2-chlorophenyl)-1,4-thiazepane (PubChem CID 90629912) has the molecular formula C17H18ClNO2S2 and a molecular weight of 367.92 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-7-(2-chlorophenyl)-1,4-thiazepane.
| Compound Name | 4-(benzenesulfonyl)-7-(2-chlorophenyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 90629912 |
| Molecular Formula | C17H18ClNO2S2 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 4-(benzenesulfonyl)-7-(2-chlorophenyl)-1,4-thiazepane |
| SMILES | O=S(=O)(c1ccccc1)N1CCSC(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H18ClNO2S2/c18-16-9-5-4-8-15(16)17-10-11-19(12-13-22-17)23(20,21)14-6-2-1-3-7-14/h1-9,17H,10-13H2 |
| InChIKey | ZZARSSGMEODLIX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |