C15H17NO2S3 — CID 90633023
4-(benzenesulfonyl)-7-thiophen-2-yl-1,4-thiazepane (PubChem CID 90633023) has the molecular formula C15H17NO2S3 and a molecular weight of 339.51 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-7-thiophen-2-yl-1,4-thiazepane.
| Compound Name | 4-(benzenesulfonyl)-7-thiophen-2-yl-1,4-thiazepane |
|---|---|
| PubChem CID | 90633023 |
| Molecular Formula | C15H17NO2S3 |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 4-(benzenesulfonyl)-7-thiophen-2-yl-1,4-thiazepane |
| SMILES | O=S(=O)(c1ccccc1)N1CCSC(c2cccs2)CC1 |
| InChI | InChI=1S/C15H17NO2S3/c17-21(18,13-5-2-1-3-6-13)16-9-8-15(20-12-10-16)14-7-4-11-19-14/h1-7,11,15H,8-10,12H2 |
| InChIKey | GOQNHRWBMBTNPX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |