C16H18ClNO2S3 — CID 90633092
4-[(4-chlorophenyl)methylsulfonyl]-7-thiophen-2-yl-1,4-thiazepane (PubChem CID 90633092) has the molecular formula C16H18ClNO2S3 and a molecular weight of 387.98 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methylsulfonyl]-7-thiophen-2-yl-1,4-thiazepane.
| Compound Name | 4-[(4-chlorophenyl)methylsulfonyl]-7-thiophen-2-yl-1,4-thiazepane |
|---|---|
| PubChem CID | 90633092 |
| Molecular Formula | C16H18ClNO2S3 |
| Molecular Weight | 387.98 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 4-[(4-chlorophenyl)methylsulfonyl]-7-thiophen-2-yl-1,4-thiazepane |
| SMILES | O=S(=O)(Cc1ccc(Cl)cc1)N1CCSC(c2cccs2)CC1 |
| InChI | InChI=1S/C16H18ClNO2S3/c17-14-5-3-13(4-6-14)12-23(19,20)18-8-7-16(22-11-9-18)15-2-1-10-21-15/h1-6,10,16H,7-9,11-12H2 |
| InChIKey | KNDYJXBRJDMWKW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.98 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |