C12H15N3O2S3 — CID 90633102
4-(1H-imidazol-5-ylsulfonyl)-7-thiophen-2-yl-1,4-thiazepane (PubChem CID 90633102) has the molecular formula C12H15N3O2S3 and a molecular weight of 329.47 g/mol. Its IUPAC name is 4-(1H-imidazol-5-ylsulfonyl)-7-thiophen-2-yl-1,4-thiazepane.
| Compound Name | 4-(1H-imidazol-5-ylsulfonyl)-7-thiophen-2-yl-1,4-thiazepane |
|---|---|
| PubChem CID | 90633102 |
| Molecular Formula | C12H15N3O2S3 |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 4-(1H-imidazol-5-ylsulfonyl)-7-thiophen-2-yl-1,4-thiazepane |
| SMILES | O=S(=O)(c1cnc[nH]1)N1CCSC(c2cccs2)CC1 |
| InChI | InChI=1S/C12H15N3O2S3/c16-20(17,12-8-13-9-14-12)15-4-3-11(19-7-5-15)10-2-1-6-18-10/h1-2,6,8-9,11H,3-5,7H2,(H,13,14) |
| InChIKey | VCLQZMKJMFDAQW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |