C9H17ClN4O2S — CID 119963875
[1-(1H-imidazol-5-ylsulfonyl)piperidin-4-yl]methanamine;hydrochloride (PubChem CID 119963875) has the molecular formula C9H17ClN4O2S and a molecular weight of 280.78 g/mol. Its IUPAC name is [1-(1H-imidazol-5-ylsulfonyl)piperidin-4-yl]methanamine;hydrochloride.
| Compound Name | [1-(1H-imidazol-5-ylsulfonyl)piperidin-4-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119963875 |
| Molecular Formula | C9H17ClN4O2S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | [1-(1H-imidazol-5-ylsulfonyl)piperidin-4-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCN(S(=O)(=O)c2cnc[nH]2)CC1 |
| InChI | InChI=1S/C9H16N4O2S.ClH/c10-5-8-1-3-13(4-2-8)16(14,15)9-6-11-7-12-9;/h6-8H,1-5,10H2,(H,11,12);1H |
| InChIKey | DWBYZGHSJURTPZ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |