About 1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol
1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol (PubChem CID 106670954) has the molecular formula C7H11N3O4S
and a molecular weight of 233.25 g/mol. Its IUPAC name is 1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol |
| PubChem CID | 106670954 |
| Molecular Formula | C7H11N3O4S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol |
| SMILES | O=S(=O)(c1cnc[nH]1)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C7H11N3O4S/c11-5-2-10(3-6(5)12)15(13,14)7-1-8-4-9-7/h1,4-6,11-12H,2-3H2,(H,8,9) |
| InChIKey | OKERWYDXEXGLEL-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 106.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol?
The IUPAC name of 1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol (CID 106670954) is 1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol.
What is the SMILES notation for 1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol?
The canonical SMILES for 1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol is O=S(=O)(c1cnc[nH]1)N1CC(O)C(O)C1.
What is the InChIKey of 1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol?
The InChIKey is OKERWYDXEXGLEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O4S/c11-5-2-10(3-6(5)12)15(13,14)7-1-8-4-9-7/h1,4-6,11-12H,2-3H2,(H,8,9).
What are the key properties of 1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol?
1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol has a molecular weight of 233.25 g/mol, XLogP of -1.86, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-3,4-diol is sourced from PubChem (CID 106670954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).