C13H15N3O5S2 — CID 90593680
5-[3-(4-methoxyphenyl)sulfonylazetidin-1-yl]sulfonyl-1H-imidazole (PubChem CID 90593680) has the molecular formula C13H15N3O5S2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-[3-(4-methoxyphenyl)sulfonylazetidin-1-yl]sulfonyl-1H-imidazole.
| Compound Name | 5-[3-(4-methoxyphenyl)sulfonylazetidin-1-yl]sulfonyl-1H-imidazole |
|---|---|
| PubChem CID | 90593680 |
| Molecular Formula | C13H15N3O5S2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 5-[3-(4-methoxyphenyl)sulfonylazetidin-1-yl]sulfonyl-1H-imidazole |
| SMILES | COc1ccc(S(=O)(=O)C2CN(S(=O)(=O)c3cnc[nH]3)C2)cc1 |
| InChI | InChI=1S/C13H15N3O5S2/c1-21-10-2-4-11(5-3-10)22(17,18)12-7-16(8-12)23(19,20)13-6-14-9-15-13/h2-6,9,12H,7-8H2,1H3,(H,14,15) |
| InChIKey | ICXCOMZWRMIZCO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |