C13H19NO5S2 — CID 90593675
3-(4-methoxyphenyl)sulfonyl-1-propylsulfonylazetidine (PubChem CID 90593675) has the molecular formula C13H19NO5S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfonyl-1-propylsulfonylazetidine.
| Compound Name | 3-(4-methoxyphenyl)sulfonyl-1-propylsulfonylazetidine |
|---|---|
| PubChem CID | 90593675 |
| Molecular Formula | C13H19NO5S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfonyl-1-propylsulfonylazetidine |
| SMILES | CCCS(=O)(=O)N1CC(S(=O)(=O)c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C13H19NO5S2/c1-3-8-20(15,16)14-9-13(10-14)21(17,18)12-6-4-11(19-2)5-7-12/h4-7,13H,3,8-10H2,1-2H3 |
| InChIKey | NASPOSOYINJNFB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |