C11H15NO5S2 — CID 72718913
3-(4-methoxyphenyl)sulfonyl-1-methylsulfonylazetidine (PubChem CID 72718913) has the molecular formula C11H15NO5S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfonyl-1-methylsulfonylazetidine.
| Compound Name | 3-(4-methoxyphenyl)sulfonyl-1-methylsulfonylazetidine |
|---|---|
| PubChem CID | 72718913 |
| Molecular Formula | C11H15NO5S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfonyl-1-methylsulfonylazetidine |
| SMILES | COc1ccc(S(=O)(=O)C2CN(S(C)(=O)=O)C2)cc1 |
| InChI | InChI=1S/C11H15NO5S2/c1-17-9-3-5-10(6-4-9)19(15,16)11-7-12(8-11)18(2,13)14/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | UPSLULPMDSTEMT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |