C22H19Cl2NO5S2 — CID 90593700
1-[4-(3,4-dichlorophenyl)phenyl]sulfonyl-3-(4-methoxyphenyl)sulfonylazetidine (PubChem CID 90593700) has the molecular formula C22H19Cl2NO5S2 and a molecular weight of 512.44 g/mol. Its IUPAC name is 1-[4-(3,4-dichlorophenyl)phenyl]sulfonyl-3-(4-methoxyphenyl)sulfonylazetidine.
| Compound Name | 1-[4-(3,4-dichlorophenyl)phenyl]sulfonyl-3-(4-methoxyphenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 90593700 |
| Molecular Formula | C22H19Cl2NO5S2 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | 1-[4-(3,4-dichlorophenyl)phenyl]sulfonyl-3-(4-methoxyphenyl)sulfonylazetidine |
| SMILES | COc1ccc(S(=O)(=O)C2CN(S(=O)(=O)c3ccc(-c4ccc(Cl)c(Cl)c4)cc3)C2)cc1 |
| InChI | InChI=1S/C22H19Cl2NO5S2/c1-30-17-5-9-18(10-6-17)31(26,27)20-13-25(14-20)32(28,29)19-7-2-15(3-8-19)16-4-11-21(23)22(24)12-16/h2-12,20H,13-14H2,1H3 |
| InChIKey | JIMIRSQSPSRWPU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |