C25H27NO5S2 — CID 90592085
4-(4-methoxyphenyl)sulfonyl-1-[4-(4-methylphenyl)phenyl]sulfonylpiperidine (PubChem CID 90592085) has the molecular formula C25H27NO5S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-1-[4-(4-methylphenyl)phenyl]sulfonylpiperidine.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-1-[4-(4-methylphenyl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 90592085 |
| Molecular Formula | C25H27NO5S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-1-[4-(4-methylphenyl)phenyl]sulfonylpiperidine |
| SMILES | COc1ccc(S(=O)(=O)C2CCN(S(=O)(=O)c3ccc(-c4ccc(C)cc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H27NO5S2/c1-19-3-5-20(6-4-19)21-7-11-25(12-8-21)33(29,30)26-17-15-24(16-18-26)32(27,28)23-13-9-22(31-2)10-14-23/h3-14,24H,15-18H2,1-2H3 |
| InChIKey | WEOGERGUNCQHON-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |