C16H21N3O5S2 — CID 71809049
4-(4-methoxyphenyl)sulfonyl-1-(1-methylimidazol-4-yl)sulfonylpiperidine (PubChem CID 71809049) has the molecular formula C16H21N3O5S2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-1-(1-methylimidazol-4-yl)sulfonylpiperidine.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-1-(1-methylimidazol-4-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 71809049 |
| Molecular Formula | C16H21N3O5S2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-1-(1-methylimidazol-4-yl)sulfonylpiperidine |
| SMILES | COc1ccc(S(=O)(=O)C2CCN(S(=O)(=O)c3cn(C)cn3)CC2)cc1 |
| InChI | InChI=1S/C16H21N3O5S2/c1-18-11-16(17-12-18)26(22,23)19-9-7-15(8-10-19)25(20,21)14-5-3-13(24-2)4-6-14/h3-6,11-12,15H,7-10H2,1-2H3 |
| InChIKey | YSDAMUHEPDQNDM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |