C17H23N5O7S2 — CID 21340801
N-hydroxy-4-(4-methoxyphenyl)sulfonyl-1-(1-methylimidazol-4-yl)sulfonyl-1,4-diazepane-5-carboxamide (PubChem CID 21340801) has the molecular formula C17H23N5O7S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is N-hydroxy-4-(4-methoxyphenyl)sulfonyl-1-(1-methylimidazol-4-yl)sulfonyl-1,4-diazepane-5-carboxamide.
| Compound Name | N-hydroxy-4-(4-methoxyphenyl)sulfonyl-1-(1-methylimidazol-4-yl)sulfonyl-1,4-diazepane-5-carboxamide |
|---|---|
| PubChem CID | 21340801 |
| Molecular Formula | C17H23N5O7S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-hydroxy-4-(4-methoxyphenyl)sulfonyl-1-(1-methylimidazol-4-yl)sulfonyl-1,4-diazepane-5-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3cn(C)cn3)CCC2C(=O)NO)cc1 |
| InChI | InChI=1S/C17H23N5O7S2/c1-20-11-16(18-12-20)31(27,28)21-8-7-15(17(23)19-24)22(10-9-21)30(25,26)14-5-3-13(29-2)4-6-14/h3-6,11-12,15,24H,7-10H2,1-2H3,(H,19,23) |
| InChIKey | CNDCCBOSTVCBMM-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|