C16H18N4O7S — CID 10716486
N-hydroxy-1-(4-methoxyphenyl)sulfonyl-4-(1,2-oxazole-5-carbonyl)piperazine-2-carboxamide (PubChem CID 10716486) has the molecular formula C16H18N4O7S and a molecular weight of 410.41 g/mol. Its IUPAC name is N-hydroxy-1-(4-methoxyphenyl)sulfonyl-4-(1,2-oxazole-5-carbonyl)piperazine-2-carboxamide.
| Compound Name | N-hydroxy-1-(4-methoxyphenyl)sulfonyl-4-(1,2-oxazole-5-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 10716486 |
| Molecular Formula | C16H18N4O7S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-hydroxy-1-(4-methoxyphenyl)sulfonyl-4-(1,2-oxazole-5-carbonyl)piperazine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)c3ccno3)CC2C(=O)NO)cc1 |
| InChI | InChI=1S/C16H18N4O7S/c1-26-11-2-4-12(5-3-11)28(24,25)20-9-8-19(10-13(20)15(21)18-23)16(22)14-6-7-17-27-14/h2-7,13,23H,8-10H2,1H3,(H,18,21) |
| InChIKey | QKBHNYUMIYQZNJ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|