C15H19N3O6S — CID 10177120
4-cyclopropyl-N-hydroxy-1-(4-methoxyphenyl)sulfonyl-5-oxopiperazine-2-carboxamide (PubChem CID 10177120) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is 4-cyclopropyl-N-hydroxy-1-(4-methoxyphenyl)sulfonyl-5-oxopiperazine-2-carboxamide.
| Compound Name | 4-cyclopropyl-N-hydroxy-1-(4-methoxyphenyl)sulfonyl-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 10177120 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-cyclopropyl-N-hydroxy-1-(4-methoxyphenyl)sulfonyl-5-oxopiperazine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CC(=O)N(C3CC3)CC2C(=O)NO)cc1 |
| InChI | InChI=1S/C15H19N3O6S/c1-24-11-4-6-12(7-5-11)25(22,23)18-9-14(19)17(10-2-3-10)8-13(18)15(20)16-21/h4-7,10,13,21H,2-3,8-9H2,1H3,(H,16,20) |
| InChIKey | MDLILMSFLWLJCB-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|