C13H16N4O7S — CID 18411988
N'-hydroxy-N'-[1-(4-methoxyphenyl)sulfonyl-3-methyl-4-oxoimidazolidin-2-yl]oxamide (PubChem CID 18411988) has the molecular formula C13H16N4O7S and a molecular weight of 372.36 g/mol. Its IUPAC name is N'-hydroxy-N'-[1-(4-methoxyphenyl)sulfonyl-3-methyl-4-oxoimidazolidin-2-yl]oxamide.
| Compound Name | N'-hydroxy-N'-[1-(4-methoxyphenyl)sulfonyl-3-methyl-4-oxoimidazolidin-2-yl]oxamide |
|---|---|
| PubChem CID | 18411988 |
| Molecular Formula | C13H16N4O7S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | N'-hydroxy-N'-[1-(4-methoxyphenyl)sulfonyl-3-methyl-4-oxoimidazolidin-2-yl]oxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CC(=O)N(C)C2N(O)C(=O)C(N)=O)cc1 |
| InChI | InChI=1S/C13H16N4O7S/c1-15-10(18)7-16(13(15)17(21)12(20)11(14)19)25(22,23)9-5-3-8(24-2)4-6-9/h3-6,13,21H,7H2,1-2H3,(H2,14,19) |
| InChIKey | TWDBCAPOQNHIGY-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 150.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|