C20H24N2O7S — CID 20712390
N,5-dihydroxy-1-[4-[(4-methoxyphenyl)methoxy]phenyl]sulfonylpiperidine-2-carboxamide (PubChem CID 20712390) has the molecular formula C20H24N2O7S and a molecular weight of 436.49 g/mol. Its IUPAC name is N,5-dihydroxy-1-[4-[(4-methoxyphenyl)methoxy]phenyl]sulfonylpiperidine-2-carboxamide.
| Compound Name | N,5-dihydroxy-1-[4-[(4-methoxyphenyl)methoxy]phenyl]sulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 20712390 |
| Molecular Formula | C20H24N2O7S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | N,5-dihydroxy-1-[4-[(4-methoxyphenyl)methoxy]phenyl]sulfonylpiperidine-2-carboxamide |
| SMILES | COc1ccc(COc2ccc(S(=O)(=O)N3CC(O)CCC3C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O7S/c1-28-16-5-2-14(3-6-16)13-29-17-7-9-18(10-8-17)30(26,27)22-12-15(23)4-11-19(22)20(24)21-25/h2-3,5-10,15,19,23,25H,4,11-13H2,1H3,(H,21,24) |
| InChIKey | BONOSAKYDDKTIZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|