C19H21FN2O7S — CID 87888440
[(2R,4R)-1-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-4-hydroxypiperidin-2-yl] N-hydroxycarbamate (PubChem CID 87888440) has the molecular formula C19H21FN2O7S and a molecular weight of 440.45 g/mol. Its IUPAC name is [(2R,4R)-1-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-4-hydroxypiperidin-2-yl] N-hydroxycarbamate.
| Compound Name | [(2R,4R)-1-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-4-hydroxypiperidin-2-yl] N-hydroxycarbamate |
|---|---|
| PubChem CID | 87888440 |
| Molecular Formula | C19H21FN2O7S |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [(2R,4R)-1-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-4-hydroxypiperidin-2-yl] N-hydroxycarbamate |
| SMILES | O=C(NO)O[C@@H]1C[C@H](O)CCN1S(=O)(=O)c1ccc(OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H21FN2O7S/c20-14-3-1-13(2-4-14)12-28-16-5-7-17(8-6-16)30(26,27)22-10-9-15(23)11-18(22)29-19(24)21-25/h1-8,15,18,23,25H,9-12H2,(H,21,24)/t15-,18-/m1/s1 |
| InChIKey | OTIOIXSQKXMEEF-CRAIPNDOSA-N |
| XLogP | 1.99 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|