C24H32FN3O6S — CID 57027278
(2R,4S)-4-(butylaminomethyl)-1-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N,4-dihydroxypiperidine-2-carboxamide (PubChem CID 57027278) has the molecular formula C24H32FN3O6S and a molecular weight of 509.60 g/mol. Its IUPAC name is (2R,4S)-4-(butylaminomethyl)-1-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N,4-dihydroxypiperidine-2-carboxamide.
| Compound Name | (2R,4S)-4-(butylaminomethyl)-1-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N,4-dihydroxypiperidine-2-carboxamide |
|---|---|
| PubChem CID | 57027278 |
| Molecular Formula | C24H32FN3O6S |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (2R,4S)-4-(butylaminomethyl)-1-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N,4-dihydroxypiperidine-2-carboxamide |
| SMILES | CCCCNC[C@]1(O)CCN(S(=O)(=O)c2ccc(OCc3ccc(F)cc3)cc2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C24H32FN3O6S/c1-2-3-13-26-17-24(30)12-14-28(22(15-24)23(29)27-31)35(32,33)21-10-8-20(9-11-21)34-16-18-4-6-19(25)7-5-18/h4-11,22,26,30-31H,2-3,12-17H2,1H3,(H,27,29)/t22-,24+/m1/s1 |
| InChIKey | QVFACMPFQMXBHR-VWNXMTODSA-N |
| XLogP | 2.18 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|