C19H21FN2O6S2 — CID 57157250
4-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methyl-1-oxo-1,4-thiazinane-3-carboxamide (PubChem CID 57157250) has the molecular formula C19H21FN2O6S2 and a molecular weight of 456.52 g/mol. Its IUPAC name is 4-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methyl-1-oxo-1,4-thiazinane-3-carboxamide.
| Compound Name | 4-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methyl-1-oxo-1,4-thiazinane-3-carboxamide |
|---|---|
| PubChem CID | 57157250 |
| Molecular Formula | C19H21FN2O6S2 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 4-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methyl-1-oxo-1,4-thiazinane-3-carboxamide |
| SMILES | CC1C(C(=O)NO)N(S(=O)(=O)c2ccc(OCc3ccc(F)cc3)cc2)CCS1=O |
| InChI | InChI=1S/C19H21FN2O6S2/c1-13-18(19(23)21-24)22(10-11-29(13)25)30(26,27)17-8-6-16(7-9-17)28-12-14-2-4-15(20)5-3-14/h2-9,13,18,24H,10-12H2,1H3,(H,21,23) |
| InChIKey | MKOWVPWESNQSNX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|