C19H21FN2O7S2 — CID 87966014
4-[4-[(3-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methyl-1,1-dioxo-1,4-thiazinane-3-carboxamide (PubChem CID 87966014) has the molecular formula C19H21FN2O7S2 and a molecular weight of 472.52 g/mol. Its IUPAC name is 4-[4-[(3-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methyl-1,1-dioxo-1,4-thiazinane-3-carboxamide.
| Compound Name | 4-[4-[(3-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methyl-1,1-dioxo-1,4-thiazinane-3-carboxamide |
|---|---|
| PubChem CID | 87966014 |
| Molecular Formula | C19H21FN2O7S2 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 4-[4-[(3-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methyl-1,1-dioxo-1,4-thiazinane-3-carboxamide |
| SMILES | CC1C(C(=O)NO)N(S(=O)(=O)c2ccc(OCc3cccc(F)c3)cc2)CCS1(=O)=O |
| InChI | InChI=1S/C19H21FN2O7S2/c1-13-18(19(23)21-24)22(9-10-30(13,25)26)31(27,28)17-7-5-16(6-8-17)29-12-14-3-2-4-15(20)11-14/h2-8,11,13,18,24H,9-10,12H2,1H3,(H,21,23) |
| InChIKey | RSEVUVBHIBVFEG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|