C19H19FN2O5S2 — CID 163690108
(3S)-4-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methylidenethiomorpholine-3-carboxamide (PubChem CID 163690108) has the molecular formula C19H19FN2O5S2 and a molecular weight of 438.50 g/mol. Its IUPAC name is (3S)-4-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methylidenethiomorpholine-3-carboxamide.
| Compound Name | (3S)-4-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methylidenethiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 163690108 |
| Molecular Formula | C19H19FN2O5S2 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | (3S)-4-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methylidenethiomorpholine-3-carboxamide |
| SMILES | C=C1SCCN(S(=O)(=O)c2ccc(OCc3ccc(F)cc3)cc2)[C@H]1C(=O)NO |
| InChI | InChI=1S/C19H19FN2O5S2/c1-13-18(19(23)21-24)22(10-11-28-13)29(25,26)17-8-6-16(7-9-17)27-12-14-2-4-15(20)5-3-14/h2-9,18,24H,1,10-12H2,(H,21,23)/t18-/m1/s1 |
| InChIKey | JSGFJYPVIWIMOA-GOSISDBHSA-N |
| XLogP | 2.53 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|