C25H26F2N4O6S — CID 139996629
2-cyclopentyl-5-[4-[(2,4-difluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide (PubChem CID 139996629) has the molecular formula C25H26F2N4O6S and a molecular weight of 548.57 g/mol. Its IUPAC name is 2-cyclopentyl-5-[4-[(2,4-difluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide.
| Compound Name | 2-cyclopentyl-5-[4-[(2,4-difluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 139996629 |
| Molecular Formula | C25H26F2N4O6S |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 2-cyclopentyl-5-[4-[(2,4-difluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide |
| SMILES | O=C(NO)C1c2c([nH]n(C3CCCC3)c2=O)CCN1S(=O)(=O)c1ccc(OCc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C25H26F2N4O6S/c26-16-6-5-15(20(27)13-16)14-37-18-7-9-19(10-8-18)38(35,36)30-12-11-21-22(23(30)24(32)29-34)25(33)31(28-21)17-3-1-2-4-17/h5-10,13,17,23,28,34H,1-4,11-12,14H2,(H,29,32) |
| InChIKey | FHNYJUBCDBKOLQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|