C28H26Cl2N4O6S — CID 139996681
5-[4-[(2,4-dichlorophenyl)methoxy]phenyl]sulfonyl-2-(2-ethylphenyl)-N-hydroxy-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide (PubChem CID 139996681) has the molecular formula C28H26Cl2N4O6S and a molecular weight of 617.51 g/mol. Its IUPAC name is 5-[4-[(2,4-dichlorophenyl)methoxy]phenyl]sulfonyl-2-(2-ethylphenyl)-N-hydroxy-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide.
| Compound Name | 5-[4-[(2,4-dichlorophenyl)methoxy]phenyl]sulfonyl-2-(2-ethylphenyl)-N-hydroxy-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 139996681 |
| Molecular Formula | C28H26Cl2N4O6S |
| Molecular Weight | 617.51 g/mol |
| Exact Mass | 616.10 |
| IUPAC Name | 5-[4-[(2,4-dichlorophenyl)methoxy]phenyl]sulfonyl-2-(2-ethylphenyl)-N-hydroxy-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide |
| SMILES | CCc1ccccc1-n1[nH]c2c(c1=O)C(C(=O)NO)N(S(=O)(=O)c1ccc(OCc3ccc(Cl)cc3Cl)cc1)CC2 |
| InChI | InChI=1S/C28H26Cl2N4O6S/c1-2-17-5-3-4-6-24(17)34-28(36)25-23(31-34)13-14-33(26(25)27(35)32-37)41(38,39)21-11-9-20(10-12-21)40-16-18-7-8-19(29)15-22(18)30/h3-12,15,26,31,37H,2,13-14,16H2,1H3,(H,32,35) |
| InChIKey | GDIKKOUTQZPHHL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|