C23H20Cl2N2O5S — CID 11785461
1-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxy-2-phenylcyclopropane-1-carboxamide (PubChem CID 11785461) has the molecular formula C23H20Cl2N2O5S and a molecular weight of 507.40 g/mol. Its IUPAC name is 1-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxy-2-phenylcyclopropane-1-carboxamide.
| Compound Name | 1-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxy-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 11785461 |
| Molecular Formula | C23H20Cl2N2O5S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | 1-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxy-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(NO)C1(NS(=O)(=O)c2ccc(OCc3ccc(Cl)cc3Cl)cc2)CC1c1ccccc1 |
| InChI | InChI=1S/C23H20Cl2N2O5S/c24-17-7-6-16(21(25)12-17)14-32-18-8-10-19(11-9-18)33(30,31)27-23(22(28)26-29)13-20(23)15-4-2-1-3-5-15/h1-12,20,27,29H,13-14H2,(H,26,28) |
| InChIKey | IZHLUQACKGTDCN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|