C29H31ClFNO7S — CID 18324033
3-[[4-[(4-chloro-2-fluorophenyl)methoxy]phenyl]sulfonylamino]-5-[3-(2-phenylethoxy)propyl]oxolane-3-carboxylic acid (PubChem CID 18324033) has the molecular formula C29H31ClFNO7S and a molecular weight of 592.09 g/mol. Its IUPAC name is 3-[[4-[(4-chloro-2-fluorophenyl)methoxy]phenyl]sulfonylamino]-5-[3-(2-phenylethoxy)propyl]oxolane-3-carboxylic acid.
| Compound Name | 3-[[4-[(4-chloro-2-fluorophenyl)methoxy]phenyl]sulfonylamino]-5-[3-(2-phenylethoxy)propyl]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 18324033 |
| Molecular Formula | C29H31ClFNO7S |
| Molecular Weight | 592.09 g/mol |
| Exact Mass | 591.15 |
| IUPAC Name | 3-[[4-[(4-chloro-2-fluorophenyl)methoxy]phenyl]sulfonylamino]-5-[3-(2-phenylethoxy)propyl]oxolane-3-carboxylic acid |
| SMILES | O=C(O)C1(NS(=O)(=O)c2ccc(OCc3ccc(Cl)cc3F)cc2)COC(CCCOCCc2ccccc2)C1 |
| InChI | InChI=1S/C29H31ClFNO7S/c30-23-9-8-22(27(31)17-23)19-38-24-10-12-26(13-11-24)40(35,36)32-29(28(33)34)18-25(39-20-29)7-4-15-37-16-14-21-5-2-1-3-6-21/h1-3,5-6,8-13,17,25,32H,4,7,14-16,18-20H2,(H,33,34) |
| InChIKey | SAXNIPQPQLEAJI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.09 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|