(4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate

C20H14ClFO3 — CID 18204640

IUPAC(4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate
SMILESO=C(Oc1ccc(OCc2ccccc2)cc1)c1ccc(Cl)cc1F
InChIInChI=1S/C20H14ClFO3/c21-15-6-11-18(19(22)12-15)20(23)25-17-9-7-16(8-10-17)24-13-14-4-2-1-3-5-14/h1-12H,13H2
InChIKeyKDVDJFJUNYIJSP-UHFFFAOYSA-N
MW356.78 g/mol
LogP5.28
Rot. Bonds5

About (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate

(4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate (PubChem CID 18204640) has the molecular formula C20H14ClFO3 and a molecular weight of 356.78 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate.

Molecular Properties

Compound Name(4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate
PubChem CID18204640
Molecular FormulaC20H14ClFO3
Molecular Weight356.78 g/mol
Exact Mass356.06
IUPAC Name(4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate
SMILESO=C(Oc1ccc(OCc2ccccc2)cc1)c1ccc(Cl)cc1F
InChIInChI=1S/C20H14ClFO3/c21-15-6-11-18(19(22)12-15)20(23)25-17-9-7-16(8-10-17)24-13-14-4-2-1-3-5-14/h1-12H,13H2
InChIKeyKDVDJFJUNYIJSP-UHFFFAOYSA-N
XLogP5.28
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms25
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500356.78
LogP ≤ 55.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate?
The IUPAC name of (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate (CID 18204640) is (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate.
What is the SMILES notation for (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate?
The canonical SMILES for (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate is O=C(Oc1ccc(OCc2ccccc2)cc1)c1ccc(Cl)cc1F.
What is the InChIKey of (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate?
The InChIKey is KDVDJFJUNYIJSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14ClFO3/c21-15-6-11-18(19(22)12-15)20(23)25-17-9-7-16(8-10-17)24-13-14-4-2-1-3-5-14/h1-12H,13H2.
What are the key properties of (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate?
(4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate has a molecular weight of 356.78 g/mol, XLogP of 5.28, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate is sourced from PubChem (CID 18204640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).