About (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate
(4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate (PubChem CID 18204640) has the molecular formula C20H14ClFO3
and a molecular weight of 356.78 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate.
Molecular Properties
| Compound Name | (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate |
| PubChem CID | 18204640 |
| Molecular Formula | C20H14ClFO3 |
| Molecular Weight | 356.78 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate |
| SMILES | O=C(Oc1ccc(OCc2ccccc2)cc1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C20H14ClFO3/c21-15-6-11-18(19(22)12-15)20(23)25-17-9-7-16(8-10-17)24-13-14-4-2-1-3-5-14/h1-12H,13H2 |
| InChIKey | KDVDJFJUNYIJSP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.78 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate?
The IUPAC name of (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate (CID 18204640) is (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate.
What is the SMILES notation for (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate?
The canonical SMILES for (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate is O=C(Oc1ccc(OCc2ccccc2)cc1)c1ccc(Cl)cc1F.
What is the InChIKey of (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate?
The InChIKey is KDVDJFJUNYIJSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14ClFO3/c21-15-6-11-18(19(22)12-15)20(23)25-17-9-7-16(8-10-17)24-13-14-4-2-1-3-5-14/h1-12H,13H2.
What are the key properties of (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate?
(4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate has a molecular weight of 356.78 g/mol, XLogP of 5.28, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylmethoxyphenyl) 4-chloro-2-fluorobenzoate is sourced from PubChem (CID 18204640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).