C22H18ClFN2O4 — CID 24538928
5-chloro-2-fluoro-N'-[2-(4-phenylmethoxyphenoxy)acetyl]benzohydrazide (PubChem CID 24538928) has the molecular formula C22H18ClFN2O4 and a molecular weight of 428.85 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N'-[2-(4-phenylmethoxyphenoxy)acetyl]benzohydrazide.
| Compound Name | 5-chloro-2-fluoro-N'-[2-(4-phenylmethoxyphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 24538928 |
| Molecular Formula | C22H18ClFN2O4 |
| Molecular Weight | 428.85 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 5-chloro-2-fluoro-N'-[2-(4-phenylmethoxyphenoxy)acetyl]benzohydrazide |
| SMILES | O=C(COc1ccc(OCc2ccccc2)cc1)NNC(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C22H18ClFN2O4/c23-16-6-11-20(24)19(12-16)22(28)26-25-21(27)14-30-18-9-7-17(8-10-18)29-13-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,25,27)(H,26,28) |
| InChIKey | DEFAKCAJWOPUNX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.85 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|