C15H12FIN2O3 — CID 55332310
2-fluoro-N'-[2-(4-iodophenoxy)acetyl]benzohydrazide (PubChem CID 55332310) has the molecular formula C15H12FIN2O3 and a molecular weight of 414.17 g/mol. Its IUPAC name is 2-fluoro-N'-[2-(4-iodophenoxy)acetyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[2-(4-iodophenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 55332310 |
| Molecular Formula | C15H12FIN2O3 |
| Molecular Weight | 414.17 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 2-fluoro-N'-[2-(4-iodophenoxy)acetyl]benzohydrazide |
| SMILES | O=C(COc1ccc(I)cc1)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C15H12FIN2O3/c16-13-4-2-1-3-12(13)15(21)19-18-14(20)9-22-11-7-5-10(17)6-8-11/h1-8H,9H2,(H,18,20)(H,19,21) |
| InChIKey | RWSDSZIBBPBEBT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|