C15H12F2N2O3 — CID 2709557
2-fluoro-N'-[2-(3-fluorophenoxy)acetyl]benzohydrazide (PubChem CID 2709557) has the molecular formula C15H12F2N2O3 and a molecular weight of 306.27 g/mol. Its IUPAC name is 2-fluoro-N'-[2-(3-fluorophenoxy)acetyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[2-(3-fluorophenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 2709557 |
| Molecular Formula | C15H12F2N2O3 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-fluoro-N'-[2-(3-fluorophenoxy)acetyl]benzohydrazide |
| SMILES | O=C(COc1cccc(F)c1)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C15H12F2N2O3/c16-10-4-3-5-11(8-10)22-9-14(20)18-19-15(21)12-6-1-2-7-13(12)17/h1-8H,9H2,(H,18,20)(H,19,21) |
| InChIKey | XSUNNCOJMPSJPG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|