C11H14FNO2 — CID 60626005
2-(3-fluorophenoxy)-N-propan-2-ylacetamide (PubChem CID 60626005) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-(3-fluorophenoxy)-N-propan-2-ylacetamide.
| Compound Name | 2-(3-fluorophenoxy)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 60626005 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-(3-fluorophenoxy)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)COc1cccc(F)c1 |
| InChI | InChI=1S/C11H14FNO2/c1-8(2)13-11(14)7-15-10-5-3-4-9(12)6-10/h3-6,8H,7H2,1-2H3,(H,13,14) |
| InChIKey | OKLXRCSUJRLEJR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |