C12H17NO3 — CID 4149029
2-(3-methoxyphenoxy)-N-propan-2-ylacetamide (PubChem CID 4149029) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(3-methoxyphenoxy)-N-propan-2-ylacetamide.
| Compound Name | 2-(3-methoxyphenoxy)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 4149029 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-(3-methoxyphenoxy)-N-propan-2-ylacetamide |
| SMILES | COc1cccc(OCC(=O)NC(C)C)c1 |
| InChI | InChI=1S/C12H17NO3/c1-9(2)13-12(14)8-16-11-6-4-5-10(7-11)15-3/h4-7,9H,8H2,1-3H3,(H,13,14) |
| InChIKey | XYOYWMNMDWALLS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |