C13H19NO4 — CID 78760764
2-(3-methoxyphenoxy)-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 78760764) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(3-methoxyphenoxy)-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-(3-methoxyphenoxy)-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 78760764 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-(3-methoxyphenoxy)-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | COCC(C)NC(=O)COc1cccc(OC)c1 |
| InChI | InChI=1S/C13H19NO4/c1-10(8-16-2)14-13(15)9-18-12-6-4-5-11(7-12)17-3/h4-7,10H,8-9H2,1-3H3,(H,14,15) |
| InChIKey | GCMQNRSMPDQYTP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |