C17H24FN3O3 — CID 110822394
4-[[2-(3-fluorophenoxy)acetyl]amino]-N-propan-2-ylpiperidine-1-carboxamide (PubChem CID 110822394) has the molecular formula C17H24FN3O3 and a molecular weight of 337.40 g/mol. Its IUPAC name is 4-[[2-(3-fluorophenoxy)acetyl]amino]-N-propan-2-ylpiperidine-1-carboxamide.
| Compound Name | 4-[[2-(3-fluorophenoxy)acetyl]amino]-N-propan-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 110822394 |
| Molecular Formula | C17H24FN3O3 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 4-[[2-(3-fluorophenoxy)acetyl]amino]-N-propan-2-ylpiperidine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CCC(NC(=O)COc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H24FN3O3/c1-12(2)19-17(23)21-8-6-14(7-9-21)20-16(22)11-24-15-5-3-4-13(18)10-15/h3-5,10,12,14H,6-9,11H2,1-2H3,(H,19,23)(H,20,22) |
| InChIKey | DENPGKBPCUPPJQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |