C17H17ClFN3O5S — CID 3971175
4-chloro-3-[[[2-(3-fluorophenoxy)acetyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 3971175) has the molecular formula C17H17ClFN3O5S and a molecular weight of 429.86 g/mol. Its IUPAC name is 4-chloro-3-[[[2-(3-fluorophenoxy)acetyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-chloro-3-[[[2-(3-fluorophenoxy)acetyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3971175 |
| Molecular Formula | C17H17ClFN3O5S |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 4-chloro-3-[[[2-(3-fluorophenoxy)acetyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)NNC(=O)COc2cccc(F)c2)c1 |
| InChI | InChI=1S/C17H17ClFN3O5S/c1-22(2)28(25,26)13-6-7-15(18)14(9-13)17(24)21-20-16(23)10-27-12-5-3-4-11(19)8-12/h3-9H,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | MXZBDBCRKGWISV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|