C15H13F2N3O2S — CID 9468538
1-[[2-(3-fluorophenoxy)acetyl]amino]-3-(2-fluorophenyl)thiourea (PubChem CID 9468538) has the molecular formula C15H13F2N3O2S and a molecular weight of 337.35 g/mol. Its IUPAC name is 1-[[2-(3-fluorophenoxy)acetyl]amino]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[[2-(3-fluorophenoxy)acetyl]amino]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9468538 |
| Molecular Formula | C15H13F2N3O2S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-[[2-(3-fluorophenoxy)acetyl]amino]-3-(2-fluorophenyl)thiourea |
| SMILES | O=C(COc1cccc(F)c1)NNC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C15H13F2N3O2S/c16-10-4-3-5-11(8-10)22-9-14(21)19-20-15(23)18-13-7-2-1-6-12(13)17/h1-8H,9H2,(H,19,21)(H2,18,20,23) |
| InChIKey | PPIJJZDNMFGXJC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|