C13H19FN4O2S — CID 8654435
1-[2-(dimethylamino)ethyl]-3-[[2-(3-fluorophenoxy)acetyl]amino]thiourea (PubChem CID 8654435) has the molecular formula C13H19FN4O2S and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[[2-(3-fluorophenoxy)acetyl]amino]thiourea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[[2-(3-fluorophenoxy)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8654435 |
| Molecular Formula | C13H19FN4O2S |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[[2-(3-fluorophenoxy)acetyl]amino]thiourea |
| SMILES | CN(C)CCNC(=S)NNC(=O)COc1cccc(F)c1 |
| InChI | InChI=1S/C13H19FN4O2S/c1-18(2)7-6-15-13(21)17-16-12(19)9-20-11-5-3-4-10(14)8-11/h3-5,8H,6-7,9H2,1-2H3,(H,16,19)(H2,15,17,21) |
| InChIKey | VUMOKIWBYWSPDB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|